C30H30F2N4O4S4 — CID 4756418
6-[5-[3-[6-(3-fluoroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)hexanamide (PubChem CID 4756418) has the molecular formula C30H30F2N4O4S4 and a molecular weight of 676.86 g/mol. Its IUPAC name is 6-[5-[3-[6-(3-fluoroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)hexanamide.
| Compound Name | 6-[5-[3-[6-(3-fluoroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 4756418 |
| Molecular Formula | C30H30F2N4O4S4 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | 6-[5-[3-[6-(3-fluoroanilino)-6-oxohexyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(3-fluorophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C(=C2SC(=S)N(CCCCCC(=O)Nc3cccc(F)c3)C2=O)SC1=S)Nc1cccc(F)c1 |
| InChI | InChI=1S/C30H30F2N4O4S4/c31-19-9-7-11-21(17-19)33-23(37)13-3-1-5-15-35-27(39)25(43-29(35)41)26-28(40)36(30(42)44-26)16-6-2-4-14-24(38)34-22-12-8-10-20(32)18-22/h7-12,17-18H,1-6,13-16H2,(H,33,37)(H,34,38) |
| InChIKey | VECLNFAYECBQJM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|