C26H22FN3O5 — CID 55725621
N-[5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]-2-methoxyphenyl]-3-fluorobenzamide (PubChem CID 55725621) has the molecular formula C26H22FN3O5 and a molecular weight of 475.48 g/mol. Its IUPAC name is N-[5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]-2-methoxyphenyl]-3-fluorobenzamide.
| Compound Name | N-[5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]-2-methoxyphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 55725621 |
| Molecular Formula | C26H22FN3O5 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[5-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]-2-methoxyphenyl]-3-fluorobenzamide |
| SMILES | COc1ccc(NC(=O)CCCN2C(=O)c3ccccc3C2=O)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H22FN3O5/c1-35-22-12-11-18(15-21(22)29-24(32)16-6-4-7-17(27)14-16)28-23(31)10-5-13-30-25(33)19-8-2-3-9-20(19)26(30)34/h2-4,6-9,11-12,14-15H,5,10,13H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | JJAJXDASVANTBL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|