C41H40BrN3O4 — CID 87492121
22-bromo-7,18-dioctyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile (PubChem CID 87492121) has the molecular formula C41H40BrN3O4 and a molecular weight of 718.69 g/mol. Its IUPAC name is 22-bromo-7,18-dioctyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile.
| Compound Name | 22-bromo-7,18-dioctyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile |
|---|---|
| PubChem CID | 87492121 |
| Molecular Formula | C41H40BrN3O4 |
| Molecular Weight | 718.69 g/mol |
| Exact Mass | 717.22 |
| IUPAC Name | 22-bromo-7,18-dioctyl-6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-11-carbonitrile |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4c(C#N)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CCCCCCCC)C5=O |
| InChI | InChI=1S/C41H40BrN3O4/c1-3-5-7-9-11-13-19-44-38(46)27-18-16-26-35-31(42)22-30-34-28(39(47)45(41(30)49)20-14-12-10-8-6-4-2)17-15-25(37(34)35)32-24(23-43)21-29(40(44)48)33(27)36(26)32/h15-18,21-22H,3-14,19-20H2,1-2H3 |
| InChIKey | LQNYEEVPBSHJSV-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.69 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|