C28H18Br2N4O4 — CID 147467663
11,22-dibromo-7,18-bis(methylaminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (PubChem CID 147467663) has the molecular formula C28H18Br2N4O4 and a molecular weight of 634.28 g/mol. Its IUPAC name is 11,22-dibromo-7,18-bis(methylaminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11,22-dibromo-7,18-bis(methylaminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 147467663 |
| Molecular Formula | C28H18Br2N4O4 |
| Molecular Weight | 634.28 g/mol |
| Exact Mass | 631.97 |
| IUPAC Name | 11,22-dibromo-7,18-bis(methylaminomethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| SMILES | CNCN1C(=O)c2ccc3c4c(Br)cc5c6c(ccc(c7c(Br)cc(c2c37)C1=O)c64)C(=O)N(CNC)C5=O |
| InChI | InChI=1S/C28H18Br2N4O4/c1-31-9-33-25(35)13-5-3-11-22-18(30)8-16-20-14(26(36)34(10-32-2)28(16)38)6-4-12(24(20)22)21-17(29)7-15(27(33)37)19(13)23(11)21/h3-8,31-32H,9-10H2,1-2H3 |
| InChIKey | FBDHLTVPQVZPJT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|