C36H31Br2NO8 — CID 122417510
4-[3,12-dibromo-5,7-bis(butoxycarbonyl)-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaen-16-yl]butanoic acid (PubChem CID 122417510) has the molecular formula C36H31Br2NO8 and a molecular weight of 765.45 g/mol. Its IUPAC name is 4-[3,12-dibromo-5,7-bis(butoxycarbonyl)-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaen-16-yl]butanoic acid.
| Compound Name | 4-[3,12-dibromo-5,7-bis(butoxycarbonyl)-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaen-16-yl]butanoic acid |
|---|---|
| PubChem CID | 122417510 |
| Molecular Formula | C36H31Br2NO8 |
| Molecular Weight | 765.45 g/mol |
| Exact Mass | 763.04 |
| IUPAC Name | 4-[3,12-dibromo-5,7-bis(butoxycarbonyl)-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6,8,10(23),11,13,18(22),19-decaen-16-yl]butanoic acid |
| SMILES | CCCCOC(=O)c1ccc2c3c(Br)cc4c5c(ccc(c6c(Br)cc(C(=O)OCCCC)c1c26)c53)C(=O)N(CCCC(=O)O)C4=O |
| InChI | InChI=1S/C36H31Br2NO8/c1-3-5-14-46-35(44)21-12-10-19-29-24(37)16-22-27-20(33(42)39(34(22)43)13-7-8-26(40)41)11-9-18(31(27)29)30-25(38)17-23(28(21)32(19)30)36(45)47-15-6-4-2/h9-12,16-17H,3-8,13-15H2,1-2H3,(H,40,41) |
| InChIKey | BNMKUTDZBZEZMX-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.45 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|