C40H44O9 — CID 132598721
tetrabutyl 1-hydroxyperylene-3,4,9,10-tetracarboxylate (PubChem CID 132598721) has the molecular formula C40H44O9 and a molecular weight of 668.78 g/mol. Its IUPAC name is tetrabutyl 1-hydroxyperylene-3,4,9,10-tetracarboxylate.
| Compound Name | tetrabutyl 1-hydroxyperylene-3,4,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 132598721 |
| Molecular Formula | C40H44O9 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | tetrabutyl 1-hydroxyperylene-3,4,9,10-tetracarboxylate |
| SMILES | CCCCOC(=O)c1ccc2c3ccc(C(=O)OCCCC)c4c(C(=O)OCCCC)cc(O)c(c5ccc(C(=O)OCCCC)c1c25)c43 |
| InChI | InChI=1S/C40H44O9/c1-5-9-19-46-37(42)27-16-13-24-25-14-17-29(39(44)48-21-11-7-3)34-30(40(45)49-22-12-8-4)23-31(41)35(36(25)34)26-15-18-28(33(27)32(24)26)38(43)47-20-10-6-2/h13-18,23,41H,5-12,19-22H2,1-4H3 |
| InChIKey | HVBFFCAACLLNEO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|