C64H90O8S — CID 122231478
tetrakis-decyl 12-thiahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,9,15,17-tetracarboxylate (PubChem CID 122231478) has the molecular formula C64H90O8S and a molecular weight of 1019.48 g/mol. Its IUPAC name is tetrakis-decyl 12-thiahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,9,15,17-tetracarboxylate.
| Compound Name | tetrakis-decyl 12-thiahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,9,15,17-tetracarboxylate |
|---|---|
| PubChem CID | 122231478 |
| Molecular Formula | C64H90O8S |
| Molecular Weight | 1019.48 g/mol |
| Exact Mass | 1018.64 |
| IUPAC Name | tetrakis-decyl 12-thiahexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene-7,9,15,17-tetracarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc2c3ccc(C(=O)OCCCCCCCCCC)c4c(C(=O)OCCCCCCCCCC)cc5sc6cc(C(=O)OCCCCCCCCCC)c1c2c6c5c43 |
| InChI | InChI=1S/C64H90O8S/c1-5-9-13-17-21-25-29-33-41-69-61(65)49-39-37-47-48-38-40-50(62(66)70-42-34-30-26-22-18-14-10-6-2)56-52(64(68)72-44-36-32-28-24-20-16-12-8-4)46-54-60(58(48)56)59-53(73-54)45-51(55(49)57(47)59)63(67)71-43-35-31-27-23-19-15-11-7-3/h37-40,45-46H,5-36,41-44H2,1-4H3 |
| InChIKey | RKIKAJYWGTWKHQ-UHFFFAOYSA-N |
| XLogP | 19.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.48 |
| LogP ≤ 5 | 19.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|