C46H46O8S2 — CID 102497376
tetrabutyl 1-thieno[3,2-b]thiophen-5-ylperylene-3,4,9,10-tetracarboxylate (PubChem CID 102497376) has the molecular formula C46H46O8S2 and a molecular weight of 791.00 g/mol. Its IUPAC name is tetrabutyl 1-thieno[3,2-b]thiophen-5-ylperylene-3,4,9,10-tetracarboxylate.
| Compound Name | tetrabutyl 1-thieno[3,2-b]thiophen-5-ylperylene-3,4,9,10-tetracarboxylate |
|---|---|
| PubChem CID | 102497376 |
| Molecular Formula | C46H46O8S2 |
| Molecular Weight | 791.00 g/mol |
| Exact Mass | 790.26 |
| IUPAC Name | tetrabutyl 1-thieno[3,2-b]thiophen-5-ylperylene-3,4,9,10-tetracarboxylate |
| SMILES | CCCCOC(=O)c1ccc2c3ccc(C(=O)OCCCC)c4c(C(=O)OCCCC)cc(-c5cc6sccc6s5)c(c5ccc(C(=O)OCCCC)c1c25)c43 |
| InChI | InChI=1S/C46H46O8S2/c1-5-9-20-51-43(47)30-16-13-27-28-14-17-32(45(49)53-22-11-7-3)41-34(46(50)54-23-12-8-4)25-33(36-26-37-35(56-36)19-24-55-37)39(42(28)41)29-15-18-31(40(30)38(27)29)44(48)52-21-10-6-2/h13-19,24-26H,5-12,20-23H2,1-4H3 |
| InChIKey | BKUVQMDRNLBCKG-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.00 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|