C54H70O8S2 — CID 144582298
ethane;tetraheptyl 8,22-dithiaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene-3,5,11,13-tetracarboxylate (PubChem CID 144582298) has the molecular formula C54H70O8S2 and a molecular weight of 911.28 g/mol. Its IUPAC name is ethane;tetraheptyl 8,22-dithiaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene-3,5,11,13-tetracarboxylate.
| Compound Name | ethane;tetraheptyl 8,22-dithiaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene-3,5,11,13-tetracarboxylate |
|---|---|
| PubChem CID | 144582298 |
| Molecular Formula | C54H70O8S2 |
| Molecular Weight | 911.28 g/mol |
| Exact Mass | 910.45 |
| IUPAC Name | ethane;tetraheptyl 8,22-dithiaheptacyclo[13.6.1.04,20.07,19.09,18.012,17.016,21]docosa-1(21),2,4(20),5,7(19),9(18),10,12(17),13,15-decaene-3,5,11,13-tetracarboxylate |
| SMILES | CC.CCCCCCCOC(=O)c1cc2sc3cc(C(=O)OCCCCCCC)c4c(C(=O)OCCCCCCC)cc5sc6cc(C(=O)OCCCCCCC)c1c1c2c3c4c5c61 |
| InChI | InChI=1S/C52H64O8S2.C2H6/c1-5-9-13-17-21-25-57-49(53)33-29-37-43-45-39(61-37)31-35(51(55)59-27-23-19-15-11-7-3)42-36(52(56)60-28-24-20-16-12-8-4)32-40-46(48(42)45)44-38(62-40)30-34(41(33)47(43)44)50(54)58-26-22-18-14-10-6-2;1-2/h29-32H,5-28H2,1-4H3;1-2H3 |
| InChIKey | GGNIUSRKMXWROY-UHFFFAOYSA-N |
| XLogP | 16.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.28 |
| LogP ≤ 5 | 16.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|