C26H16O10 — CID 175260534
10-ethoxycarbonyl-1,7-dihydroxyperylene-3,4,9-tricarboxylic acid (PubChem CID 175260534) has the molecular formula C26H16O10 and a molecular weight of 488.40 g/mol. Its IUPAC name is 10-ethoxycarbonyl-1,7-dihydroxyperylene-3,4,9-tricarboxylic acid.
| Compound Name | 10-ethoxycarbonyl-1,7-dihydroxyperylene-3,4,9-tricarboxylic acid |
|---|---|
| PubChem CID | 175260534 |
| Molecular Formula | C26H16O10 |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 10-ethoxycarbonyl-1,7-dihydroxyperylene-3,4,9-tricarboxylic acid |
| SMILES | CCOC(=O)c1ccc2c3c(O)cc(C(=O)O)c4c(C(=O)O)ccc(c5c(O)cc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C26H16O10/c1-2-36-26(35)12-6-4-10-19-15(27)7-13(24(31)32)17-11(23(29)30)5-3-9(21(17)19)20-16(28)8-14(25(33)34)18(12)22(10)20/h3-8,27-28H,2H2,1H3,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | WMLDWUOFDPNRKE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|