C24H12O9 — CID 12714696
1-hydroxyperylene-3,4,9,10-tetracarboxylic acid (PubChem CID 12714696) has the molecular formula C24H12O9 and a molecular weight of 444.35 g/mol. Its IUPAC name is 1-hydroxyperylene-3,4,9,10-tetracarboxylic acid.
| Compound Name | 1-hydroxyperylene-3,4,9,10-tetracarboxylic acid |
|---|---|
| PubChem CID | 12714696 |
| Molecular Formula | C24H12O9 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 1-hydroxyperylene-3,4,9,10-tetracarboxylic acid |
| SMILES | O=C(O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)cc(O)c(c5ccc(C(=O)O)c1c25)c43 |
| InChI | InChI=1S/C24H12O9/c25-15-7-14(24(32)33)18-13(23(30)31)5-2-9-8-1-4-11(21(26)27)17-12(22(28)29)6-3-10(16(8)17)19(15)20(9)18/h1-7,25H,(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | FUBHUJLSHPTFRK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|