C32H24N2O6 — CID 175255963
9,10-dicarbamoylperylene-3,4-dicarboxylic acid;1,3-xylene (PubChem CID 175255963) has the molecular formula C32H24N2O6 and a molecular weight of 532.55 g/mol. Its IUPAC name is 9,10-dicarbamoylperylene-3,4-dicarboxylic acid;1,3-xylene.
| Compound Name | 9,10-dicarbamoylperylene-3,4-dicarboxylic acid;1,3-xylene |
|---|---|
| PubChem CID | 175255963 |
| Molecular Formula | C32H24N2O6 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 9,10-dicarbamoylperylene-3,4-dicarboxylic acid;1,3-xylene |
| SMILES | Cc1cccc(C)c1.NC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5ccc(C(N)=O)c1c25)c43 |
| InChI | InChI=1S/C24H14N2O6.C8H10/c25-21(27)13-5-1-9-11-3-7-15(23(29)30)20-16(24(31)32)8-4-12(18(11)20)10-2-6-14(22(26)28)19(13)17(9)10;1-7-4-3-5-8(2)6-7/h1-8H,(H2,25,27)(H2,26,28)(H,29,30)(H,31,32);3-6H,1-2H3 |
| InChIKey | ZFBSMAJXUJCDKB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|