C24H14N2O6 — CID 175502614
3,4-dicarbamoylperylene-1,10-dicarboxylic acid (PubChem CID 175502614) has the molecular formula C24H14N2O6 and a molecular weight of 426.38 g/mol. Its IUPAC name is 3,4-dicarbamoylperylene-1,10-dicarboxylic acid.
| Compound Name | 3,4-dicarbamoylperylene-1,10-dicarboxylic acid |
|---|---|
| PubChem CID | 175502614 |
| Molecular Formula | C24H14N2O6 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 3,4-dicarbamoylperylene-1,10-dicarboxylic acid |
| SMILES | NC(=O)c1ccc2c3cccc4c(C(=O)O)ccc(c5c(C(=O)O)cc(C(N)=O)c1c25)c43 |
| InChI | InChI=1S/C24H14N2O6/c25-21(27)14-7-4-11-9-2-1-3-10-12(23(29)30)5-6-13(17(9)10)18-16(24(31)32)8-15(22(26)28)19(14)20(11)18/h1-8H,(H2,25,27)(H2,26,28)(H,29,30)(H,31,32) |
| InChIKey | RRVTWRUEDXGCJP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|