C25H12BrF3N2O6 — CID 171473020
1-bromo-9,10-dicarbamoyl-7-(trifluoromethyl)perylene-3,4-dicarboxylic acid (PubChem CID 171473020) has the molecular formula C25H12BrF3N2O6 and a molecular weight of 573.28 g/mol. Its IUPAC name is 1-bromo-9,10-dicarbamoyl-7-(trifluoromethyl)perylene-3,4-dicarboxylic acid.
| Compound Name | 1-bromo-9,10-dicarbamoyl-7-(trifluoromethyl)perylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 171473020 |
| Molecular Formula | C25H12BrF3N2O6 |
| Molecular Weight | 573.28 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | 1-bromo-9,10-dicarbamoyl-7-(trifluoromethyl)perylene-3,4-dicarboxylic acid |
| SMILES | NC(=O)c1ccc2c3c(Br)cc(C(=O)O)c4c(C(=O)O)ccc(c5c(C(F)(F)F)cc(C(N)=O)c1c25)c43 |
| InChI | InChI=1S/C25H12BrF3N2O6/c26-14-6-12(24(36)37)16-10(23(34)35)4-2-7-17-13(25(27,28)29)5-11(22(31)33)15-9(21(30)32)3-1-8(19(15)17)18(14)20(7)16/h1-6H,(H2,30,32)(H2,31,33)(H,34,35)(H,36,37) |
| InChIKey | NBLCOCOAZBAVBG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|