C24H12Br2N2O6 — CID 141032207
7,8-dibromo-9,10-dicarbamoylperylene-3,4-dicarboxylic acid (PubChem CID 141032207) has the molecular formula C24H12Br2N2O6 and a molecular weight of 584.18 g/mol. Its IUPAC name is 7,8-dibromo-9,10-dicarbamoylperylene-3,4-dicarboxylic acid.
| Compound Name | 7,8-dibromo-9,10-dicarbamoylperylene-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 141032207 |
| Molecular Formula | C24H12Br2N2O6 |
| Molecular Weight | 584.18 g/mol |
| Exact Mass | 581.91 |
| IUPAC Name | 7,8-dibromo-9,10-dicarbamoylperylene-3,4-dicarboxylic acid |
| SMILES | NC(=O)c1ccc2c3ccc(C(=O)O)c4c(C(=O)O)ccc(c5c(Br)c(Br)c(C(N)=O)c1c25)c43 |
| InChI | InChI=1S/C24H12Br2N2O6/c25-19-17-9-3-6-12(24(33)34)14-11(23(31)32)5-2-7(13(9)14)8-1-4-10(21(27)29)16(15(8)17)18(20(19)26)22(28)30/h1-6H,(H2,27,29)(H2,28,30)(H,31,32)(H,33,34) |
| InChIKey | QJHWOMCRFVNLOA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|