C23H13ClN2O3 — CID 87937117
9,10-dicarbamoylperylene-3-carbonyl chloride (PubChem CID 87937117) has the molecular formula C23H13ClN2O3 and a molecular weight of 400.82 g/mol. Its IUPAC name is 9,10-dicarbamoylperylene-3-carbonyl chloride.
| Compound Name | 9,10-dicarbamoylperylene-3-carbonyl chloride |
|---|---|
| PubChem CID | 87937117 |
| Molecular Formula | C23H13ClN2O3 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 9,10-dicarbamoylperylene-3-carbonyl chloride |
| SMILES | NC(=O)c1ccc2c3cccc4c(C(=O)Cl)ccc(c5ccc(C(N)=O)c1c25)c43 |
| InChI | InChI=1S/C23H13ClN2O3/c24-21(27)15-7-4-12-14-6-9-17(23(26)29)20-16(22(25)28)8-5-13(19(14)20)10-2-1-3-11(15)18(10)12/h1-9H,(H2,25,28)(H2,26,29) |
| InChIKey | FRBUAAZDCZLBBS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|