C24H13NO4 — CID 163566588
4,9,10-triformylperylene-3-carboxamide (PubChem CID 163566588) has the molecular formula C24H13NO4 and a molecular weight of 379.37 g/mol. Its IUPAC name is 4,9,10-triformylperylene-3-carboxamide.
| Compound Name | 4,9,10-triformylperylene-3-carboxamide |
|---|---|
| PubChem CID | 163566588 |
| Molecular Formula | C24H13NO4 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 4,9,10-triformylperylene-3-carboxamide |
| SMILES | NC(=O)c1ccc2c3ccc(C=O)c4c(C=O)ccc(c5ccc(C=O)c1c52)c43 |
| InChI | InChI=1S/C24H13NO4/c25-24(29)19-8-7-18-16-5-2-13(10-27)20-12(9-26)1-4-15(22(16)20)17-6-3-14(11-28)21(19)23(17)18/h1-11H,(H2,25,29) |
| InChIKey | FVSYDQXCQZLWDZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|