C19H20O4 — CID 143543036
ethane;4,5,8-triacetylnaphthalene-1-carbaldehyde (PubChem CID 143543036) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethane;4,5,8-triacetylnaphthalene-1-carbaldehyde.
| Compound Name | ethane;4,5,8-triacetylnaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 143543036 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethane;4,5,8-triacetylnaphthalene-1-carbaldehyde |
| SMILES | CC.CC(=O)c1ccc(C(C)=O)c2c(C(C)=O)ccc(C=O)c12 |
| InChI | InChI=1S/C17H14O4.C2H6/c1-9(19)13-6-7-15(11(3)21)17-14(10(2)20)5-4-12(8-18)16(13)17;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | BOTYOFMMRQPLFR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|