C26H18N2O5 — CID 88871085
4-formyl-5,8-bis(phenylcarbamoyl)naphthalene-1-carboxylic acid (PubChem CID 88871085) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is 4-formyl-5,8-bis(phenylcarbamoyl)naphthalene-1-carboxylic acid.
| Compound Name | 4-formyl-5,8-bis(phenylcarbamoyl)naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 88871085 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-formyl-5,8-bis(phenylcarbamoyl)naphthalene-1-carboxylic acid |
| SMILES | O=Cc1ccc(C(=O)O)c2c(C(=O)Nc3ccccc3)ccc(C(=O)Nc3ccccc3)c12 |
| InChI | InChI=1S/C26H18N2O5/c29-15-16-11-12-21(26(32)33)23-20(25(31)28-18-9-5-2-6-10-18)14-13-19(22(16)23)24(30)27-17-7-3-1-4-8-17/h1-15H,(H,27,30)(H,28,31)(H,32,33) |
| InChIKey | ZAVMAICDMGFWED-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|