C28H28F6N2O5 — CID 88871083
5-formyl-4,8-bis[[4-(trifluoromethyl)cyclohexyl]carbamoyl]naphthalene-1-carboxylic acid (PubChem CID 88871083) has the molecular formula C28H28F6N2O5 and a molecular weight of 586.53 g/mol. Its IUPAC name is 5-formyl-4,8-bis[[4-(trifluoromethyl)cyclohexyl]carbamoyl]naphthalene-1-carboxylic acid.
| Compound Name | 5-formyl-4,8-bis[[4-(trifluoromethyl)cyclohexyl]carbamoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 88871083 |
| Molecular Formula | C28H28F6N2O5 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 5-formyl-4,8-bis[[4-(trifluoromethyl)cyclohexyl]carbamoyl]naphthalene-1-carboxylic acid |
| SMILES | O=Cc1ccc(C(=O)NC2CCC(C(F)(F)F)CC2)c2c(C(=O)O)ccc(C(=O)NC3CCC(C(F)(F)F)CC3)c12 |
| InChI | InChI=1S/C28H28F6N2O5/c29-27(30,31)15-2-6-17(7-3-15)35-24(38)19-11-12-21(26(40)41)23-20(10-1-14(13-37)22(19)23)25(39)36-18-8-4-16(5-9-18)28(32,33)34/h1,10-13,15-18H,2-9H2,(H,35,38)(H,36,39)(H,40,41) |
| InChIKey | WBUYMKZWBUIKMJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|