C27H33NO4 — CID 58526808
8-(2-cyclohexylacetyl)-4-(cyclohexylcarbamoyl)-5-methylnaphthalene-1-carboxylic acid (PubChem CID 58526808) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 8-(2-cyclohexylacetyl)-4-(cyclohexylcarbamoyl)-5-methylnaphthalene-1-carboxylic acid.
| Compound Name | 8-(2-cyclohexylacetyl)-4-(cyclohexylcarbamoyl)-5-methylnaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 58526808 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 8-(2-cyclohexylacetyl)-4-(cyclohexylcarbamoyl)-5-methylnaphthalene-1-carboxylic acid |
| SMILES | Cc1ccc(C(=O)CC2CCCCC2)c2c(C(=O)O)ccc(C(=O)NC3CCCCC3)c12 |
| InChI | InChI=1S/C27H33NO4/c1-17-12-13-20(23(29)16-18-8-4-2-5-9-18)25-22(27(31)32)15-14-21(24(17)25)26(30)28-19-10-6-3-7-11-19/h12-15,18-19H,2-11,16H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | VOTWCLLJFRQSEX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |