C37H52NO4- — CID 58526816
5-methyl-8-[2-(4-pentylcyclohexyl)acetyl]-4-[(4-pentylcyclohexyl)carbamoyl]naphthalene-1-carboxylate (PubChem CID 58526816) has the molecular formula C37H52NO4- and a molecular weight of 574.83 g/mol. Its IUPAC name is 5-methyl-8-[2-(4-pentylcyclohexyl)acetyl]-4-[(4-pentylcyclohexyl)carbamoyl]naphthalene-1-carboxylate.
| Compound Name | 5-methyl-8-[2-(4-pentylcyclohexyl)acetyl]-4-[(4-pentylcyclohexyl)carbamoyl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 58526816 |
| Molecular Formula | C37H52NO4- |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | 5-methyl-8-[2-(4-pentylcyclohexyl)acetyl]-4-[(4-pentylcyclohexyl)carbamoyl]naphthalene-1-carboxylate |
| SMILES | CCCCCC1CCC(CC(=O)c2ccc(C)c3c(C(=O)NC4CCC(CCCCC)CC4)ccc(C(=O)[O-])c23)CC1 |
| InChI | InChI=1S/C37H53NO4/c1-4-6-8-10-26-13-15-28(16-14-26)24-33(39)30-21-12-25(3)34-31(22-23-32(35(30)34)37(41)42)36(40)38-29-19-17-27(18-20-29)11-9-7-5-2/h12,21-23,26-29H,4-11,13-20,24H2,1-3H3,(H,38,40)(H,41,42)/p-1 |
| InChIKey | BZWPMFGVGRZVNV-UHFFFAOYSA-M |
| XLogP | 8.34 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|