C53H76N3O4+ — CID 158629333
4-(2-cyclopentylacetyl)-10-(cyclopentylcarbamoyl)-9-methylperylene-3-carboxylate;bis(tripropylazanium) (PubChem CID 158629333) has the molecular formula C53H76N3O4+ and a molecular weight of 819.21 g/mol. Its IUPAC name is 4-(2-cyclopentylacetyl)-10-(cyclopentylcarbamoyl)-9-methylperylene-3-carboxylate;bis(tripropylazanium).
| Compound Name | 4-(2-cyclopentylacetyl)-10-(cyclopentylcarbamoyl)-9-methylperylene-3-carboxylate;bis(tripropylazanium) |
|---|---|
| PubChem CID | 158629333 |
| Molecular Formula | C53H76N3O4+ |
| Molecular Weight | 819.21 g/mol |
| Exact Mass | 818.58 |
| IUPAC Name | 4-(2-cyclopentylacetyl)-10-(cyclopentylcarbamoyl)-9-methylperylene-3-carboxylate;bis(tripropylazanium) |
| SMILES | CCC[NH+](CCC)CCC.CCC[NH+](CCC)CCC.Cc1ccc2c3ccc(C(=O)CC4CCCC4)c4c(C(=O)[O-])ccc(c5ccc(C(=O)NC6CCCC6)c1c52)c43 |
| InChI | InChI=1S/C35H33NO4.2C9H21N/c1-19-10-11-22-24-12-15-26(29(37)18-20-6-2-3-7-20)33-28(35(39)40)17-14-25(32(24)33)23-13-16-27(30(19)31(22)23)34(38)36-21-8-4-5-9-21;2*1-4-7-10(8-5-2)9-6-3/h10-17,20-21H,2-9,18H2,1H3,(H,36,38)(H,39,40);2*4-9H2,1-3H3/p+1 |
| InChIKey | HYZLZRWJPDBNLC-UHFFFAOYSA-O |
| XLogP | 9.05 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.21 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|