C39H40NO4- — CID 58526820
9-methyl-4-[2-(4-methylcyclohexyl)acetyl]-10-[(4-methylcyclohexyl)carbamoyl]perylene-3-carboxylate (PubChem CID 58526820) has the molecular formula C39H40NO4- and a molecular weight of 586.75 g/mol. Its IUPAC name is 9-methyl-4-[2-(4-methylcyclohexyl)acetyl]-10-[(4-methylcyclohexyl)carbamoyl]perylene-3-carboxylate.
| Compound Name | 9-methyl-4-[2-(4-methylcyclohexyl)acetyl]-10-[(4-methylcyclohexyl)carbamoyl]perylene-3-carboxylate |
|---|---|
| PubChem CID | 58526820 |
| Molecular Formula | C39H40NO4- |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 9-methyl-4-[2-(4-methylcyclohexyl)acetyl]-10-[(4-methylcyclohexyl)carbamoyl]perylene-3-carboxylate |
| SMILES | Cc1ccc2c3ccc(C(=O)CC4CCC(C)CC4)c4c(C(=O)[O-])ccc(c5ccc(C(=O)NC6CCC(C)CC6)c1c52)c43 |
| InChI | InChI=1S/C39H41NO4/c1-21-4-9-24(10-5-21)20-33(41)30-17-14-28-26-13-8-23(3)34-31(38(42)40-25-11-6-22(2)7-12-25)18-15-27(35(26)34)29-16-19-32(39(43)44)37(30)36(28)29/h8,13-19,21-22,24-25H,4-7,9-12,20H2,1-3H3,(H,40,42)(H,43,44)/p-1 |
| InChIKey | FZAFBAPQNKFPBY-UHFFFAOYSA-M |
| XLogP | 8.12 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|