C37H37NO4 — CID 58526845
4-(2-cyclohexylacetyl)-10-(cyclohexylcarbamoyl)-9-methylperylene-3-carboxylic acid (PubChem CID 58526845) has the molecular formula C37H37NO4 and a molecular weight of 559.71 g/mol. Its IUPAC name is 4-(2-cyclohexylacetyl)-10-(cyclohexylcarbamoyl)-9-methylperylene-3-carboxylic acid.
| Compound Name | 4-(2-cyclohexylacetyl)-10-(cyclohexylcarbamoyl)-9-methylperylene-3-carboxylic acid |
|---|---|
| PubChem CID | 58526845 |
| Molecular Formula | C37H37NO4 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-(2-cyclohexylacetyl)-10-(cyclohexylcarbamoyl)-9-methylperylene-3-carboxylic acid |
| SMILES | Cc1ccc2c3ccc(C(=O)CC4CCCCC4)c4c(C(=O)O)ccc(c5ccc(C(=O)NC6CCCCC6)c1c52)c43 |
| InChI | InChI=1S/C37H37NO4/c1-21-12-13-24-26-14-17-28(31(39)20-22-8-4-2-5-9-22)35-30(37(41)42)19-16-27(34(26)35)25-15-18-29(32(21)33(24)25)36(40)38-23-10-6-3-7-11-23/h12-19,22-23H,2-11,20H2,1H3,(H,38,40)(H,41,42) |
| InChIKey | GDDRQZZADLPNKM-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|