C16H18F3NO3 — CID 47048188
methyl 3-[[4-(trifluoromethyl)cyclohexyl]carbamoyl]benzoate (PubChem CID 47048188) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is methyl 3-[[4-(trifluoromethyl)cyclohexyl]carbamoyl]benzoate.
| Compound Name | methyl 3-[[4-(trifluoromethyl)cyclohexyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 47048188 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | methyl 3-[[4-(trifluoromethyl)cyclohexyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C16H18F3NO3/c1-23-15(22)11-4-2-3-10(9-11)14(21)20-13-7-5-12(6-8-13)16(17,18)19/h2-4,9,12-13H,5-8H2,1H3,(H,20,21) |
| InChIKey | QQEQVWLHUOEVAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |