C16H20F3NOS — CID 43052123
3-(methylsulfanylmethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 43052123) has the molecular formula C16H20F3NOS and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-(methylsulfanylmethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 3-(methylsulfanylmethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 43052123 |
| Molecular Formula | C16H20F3NOS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 3-(methylsulfanylmethyl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CSCc1cccc(C(=O)NC2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C16H20F3NOS/c1-22-10-11-3-2-4-12(9-11)15(21)20-14-7-5-13(6-8-14)16(17,18)19/h2-4,9,13-14H,5-8,10H2,1H3,(H,20,21) |
| InChIKey | IAVOXBBHRMJNIX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |