C14H14Br2F3NO — CID 107980263
3,5-dibromo-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 107980263) has the molecular formula C14H14Br2F3NO and a molecular weight of 429.07 g/mol. Its IUPAC name is 3,5-dibromo-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 3,5-dibromo-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 107980263 |
| Molecular Formula | C14H14Br2F3NO |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 3,5-dibromo-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(C(F)(F)F)CC1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H14Br2F3NO/c15-10-5-8(6-11(16)7-10)13(21)20-12-3-1-9(2-4-12)14(17,18)19/h5-7,9,12H,1-4H2,(H,20,21) |
| InChIKey | IXDSCOIUSNVZFX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |