C13H13Br2NO3 — CID 106320556
cis-(1R,3S)-3-[(3,5-dibromobenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 106320556) has the molecular formula C13H13Br2NO3 and a molecular weight of 391.06 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(3,5-dibromobenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(3,5-dibromobenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106320556 |
| Molecular Formula | C13H13Br2NO3 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | cis-(1R,3S)-3-[(3,5-dibromobenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H13Br2NO3/c14-9-3-8(4-10(15)6-9)12(17)16-11-2-1-7(5-11)13(18)19/h3-4,6-7,11H,1-2,5H2,(H,16,17)(H,18,19)/t7-,11+/m1/s1 |
| InChIKey | KGZIOWJKSFDMJQ-HQJQHLMTSA-N |
| XLogP | 3.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |