C13H15Br2NO2 — CID 103908540
3,5-dibromo-N-(2-methyloxan-4-yl)benzamide (PubChem CID 103908540) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 3,5-dibromo-N-(2-methyloxan-4-yl)benzamide.
| Compound Name | 3,5-dibromo-N-(2-methyloxan-4-yl)benzamide |
|---|---|
| PubChem CID | 103908540 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 3,5-dibromo-N-(2-methyloxan-4-yl)benzamide |
| SMILES | CC1CC(NC(=O)c2cc(Br)cc(Br)c2)CCO1 |
| InChI | InChI=1S/C13H15Br2NO2/c1-8-4-12(2-3-18-8)16-13(17)9-5-10(14)7-11(15)6-9/h5-8,12H,2-4H2,1H3,(H,16,17) |
| InChIKey | WPWKEACVPSNOLF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |