C14H15F4NO2 — CID 103888185
4-fluoro-N-(2-methyloxan-4-yl)-3-(trifluoromethyl)benzamide (PubChem CID 103888185) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is 4-fluoro-N-(2-methyloxan-4-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-(2-methyloxan-4-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103888185 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-fluoro-N-(2-methyloxan-4-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CC1CC(NC(=O)c2ccc(F)c(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C14H15F4NO2/c1-8-6-10(4-5-21-8)19-13(20)9-2-3-12(15)11(7-9)14(16,17)18/h2-3,7-8,10H,4-6H2,1H3,(H,19,20) |
| InChIKey | CGLRWIKEPQHTGX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |