C13H15BrN2O3 — CID 106322664
cis-(1R,3S)-3-[(4-amino-3-bromobenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 106322664) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(4-amino-3-bromobenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(4-amino-3-bromobenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106322664 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | cis-(1R,3S)-3-[(4-amino-3-bromobenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | Nc1ccc(C(=O)N[C@H]2CC[C@@H](C(=O)O)C2)cc1Br |
| InChI | InChI=1S/C13H15BrN2O3/c14-10-6-7(2-4-11(10)15)12(17)16-9-3-1-8(5-9)13(18)19/h2,4,6,8-9H,1,3,5,15H2,(H,16,17)(H,18,19)/t8-,9+/m1/s1 |
| InChIKey | XQNRBVCJWSVSIR-BDAKNGLRSA-N |
| XLogP | 2.01 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|