C13H14INO4 — CID 106321411
cis-(1R,3S)-3-[(3-hydroxy-4-iodobenzoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 106321411) has the molecular formula C13H14INO4 and a molecular weight of 375.16 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(3-hydroxy-4-iodobenzoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(3-hydroxy-4-iodobenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106321411 |
| Molecular Formula | C13H14INO4 |
| Molecular Weight | 375.16 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | cis-(1R,3S)-3-[(3-hydroxy-4-iodobenzoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C13H14INO4/c14-10-4-2-7(6-11(10)16)12(17)15-9-3-1-8(5-9)13(18)19/h2,4,6,8-9,16H,1,3,5H2,(H,15,17)(H,18,19)/t8-,9+/m1/s1 |
| InChIKey | WTNWRBXGJUNNPP-BDAKNGLRSA-N |
| XLogP | 1.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|