C13H13BrClF3N2O — CID 62001027
5-bromo-2-chloro-N-[4-(trifluoromethyl)cyclohexyl]pyridine-3-carboxamide (PubChem CID 62001027) has the molecular formula C13H13BrClF3N2O and a molecular weight of 385.61 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[4-(trifluoromethyl)cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[4-(trifluoromethyl)cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62001027 |
| Molecular Formula | C13H13BrClF3N2O |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[4-(trifluoromethyl)cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCC(C(F)(F)F)CC1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C13H13BrClF3N2O/c14-8-5-10(11(15)19-6-8)12(21)20-9-3-1-7(2-4-9)13(16,17)18/h5-7,9H,1-4H2,(H,20,21) |
| InChIKey | ZOHXQVNZJRBGEM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|