C14H9BrClF3N2O — CID 52780386
5-bromo-2-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 52780386) has the molecular formula C14H9BrClF3N2O and a molecular weight of 393.59 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 52780386 |
| Molecular Formula | C14H9BrClF3N2O |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Br)cnc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H9BrClF3N2O/c1-7-2-3-9(5-11(7)14(17,18)19)21-13(22)10-4-8(15)6-20-12(10)16/h2-6H,1H3,(H,21,22) |
| InChIKey | NQXOEXBQMILWAG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|