C12H9BrClN3O3S — CID 62000829
5-bromo-2-chloro-N-(6-methylsulfonyl-3-pyridinyl)pyridine-3-carboxamide (PubChem CID 62000829) has the molecular formula C12H9BrClN3O3S and a molecular weight of 390.65 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(6-methylsulfonyl-3-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-(6-methylsulfonyl-3-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62000829 |
| Molecular Formula | C12H9BrClN3O3S |
| Molecular Weight | 390.65 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 5-bromo-2-chloro-N-(6-methylsulfonyl-3-pyridinyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2cc(Br)cnc2Cl)cn1 |
| InChI | InChI=1S/C12H9BrClN3O3S/c1-21(19,20)10-3-2-8(6-15-10)17-12(18)9-4-7(13)5-16-11(9)14/h2-6H,1H3,(H,17,18) |
| InChIKey | MONLFJIDELAXEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|