C12H14BrClN2O2 — CID 94415434
5-bromo-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-3-carboxamide (PubChem CID 94415434) has the molecular formula C12H14BrClN2O2 and a molecular weight of 333.61 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 94415434 |
| Molecular Formula | C12H14BrClN2O2 |
| Molecular Weight | 333.61 g/mol |
| Exact Mass | 331.99 |
| IUPAC Name | 5-bromo-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C12H14BrClN2O2/c13-7-5-8(11(14)15-6-7)12(18)16-9-3-1-2-4-10(9)17/h5-6,9-10,17H,1-4H2,(H,16,18)/t9-,10-/m0/s1 |
| InChIKey | DMQYMQGXLGPKQX-UWVGGRQHSA-N |
| XLogP | 2.53 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.61 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|