C12H16ClN3O2 — CID 114089621
5-amino-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-4-carboxamide (PubChem CID 114089621) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-4-carboxamide.
| Compound Name | 5-amino-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114089621 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-amino-2-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]pyridine-4-carboxamide |
| SMILES | Nc1cnc(Cl)cc1C(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C12H16ClN3O2/c13-11-5-7(8(14)6-15-11)12(18)16-9-3-1-2-4-10(9)17/h5-6,9-10,17H,1-4,14H2,(H,16,18)/t9-,10-/m0/s1 |
| InChIKey | RPJKKEPRNMXHPT-UWVGGRQHSA-N |
| XLogP | 1.35 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|