C9H10ClN3O — CID 156880832
4-amino-6-chloro-N-cyclopropylpyridine-3-carboxamide (PubChem CID 156880832) has the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. Its IUPAC name is 4-amino-6-chloro-N-cyclopropylpyridine-3-carboxamide.
| Compound Name | 4-amino-6-chloro-N-cyclopropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156880832 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 4-amino-6-chloro-N-cyclopropylpyridine-3-carboxamide |
| SMILES | Nc1cc(Cl)ncc1C(=O)NC1CC1 |
| InChI | InChI=1S/C9H10ClN3O/c10-8-3-7(11)6(4-12-8)9(14)13-5-1-2-5/h3-5H,1-2H2,(H2,11,12)(H,13,14) |
| InChIKey | PVELDVYJNUAEPN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|