C22H32F3N5O — CID 67978832
5-amino-2-(4-cyclopropylpiperazin-1-yl)-4-(methylamino)-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 67978832) has the molecular formula C22H32F3N5O and a molecular weight of 439.53 g/mol. Its IUPAC name is 5-amino-2-(4-cyclopropylpiperazin-1-yl)-4-(methylamino)-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 5-amino-2-(4-cyclopropylpiperazin-1-yl)-4-(methylamino)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 67978832 |
| Molecular Formula | C22H32F3N5O |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 5-amino-2-(4-cyclopropylpiperazin-1-yl)-4-(methylamino)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | CNc1cc(N2CCN(C3CC3)CC2)c(C(=O)NC2CCC(C(F)(F)F)CC2)cc1N |
| InChI | InChI=1S/C22H32F3N5O/c1-27-19-13-20(30-10-8-29(9-11-30)16-6-7-16)17(12-18(19)26)21(31)28-15-4-2-14(3-5-15)22(23,24)25/h12-16,27H,2-11,26H2,1H3,(H,28,31) |
| InChIKey | AVQOXAKEYRZRNH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|