C15H20F4N4O — CID 67978849
5-amino-2-(4-fluoropiperidin-1-yl)-4-(methylamino)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 67978849) has the molecular formula C15H20F4N4O and a molecular weight of 348.34 g/mol. Its IUPAC name is 5-amino-2-(4-fluoropiperidin-1-yl)-4-(methylamino)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 5-amino-2-(4-fluoropiperidin-1-yl)-4-(methylamino)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 67978849 |
| Molecular Formula | C15H20F4N4O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-amino-2-(4-fluoropiperidin-1-yl)-4-(methylamino)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CNc1cc(N2CCC(F)CC2)c(C(=O)NCC(F)(F)F)cc1N |
| InChI | InChI=1S/C15H20F4N4O/c1-21-12-7-13(23-4-2-9(16)3-5-23)10(6-11(12)20)14(24)22-8-15(17,18)19/h6-7,9,21H,2-5,8,20H2,1H3,(H,22,24) |
| InChIKey | RSQHGFMBDUMWJB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|