C20H32N4O — CID 123494767
5-amino-N-(cyclohexylmethyl)-4-(methylamino)-2-piperidin-1-ylbenzamide (PubChem CID 123494767) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is 5-amino-N-(cyclohexylmethyl)-4-(methylamino)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-amino-N-(cyclohexylmethyl)-4-(methylamino)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 123494767 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 5-amino-N-(cyclohexylmethyl)-4-(methylamino)-2-piperidin-1-ylbenzamide |
| SMILES | CNc1cc(N2CCCCC2)c(C(=O)NCC2CCCCC2)cc1N |
| InChI | InChI=1S/C20H32N4O/c1-22-18-13-19(24-10-6-3-7-11-24)16(12-17(18)21)20(25)23-14-15-8-4-2-5-9-15/h12-13,15,22H,2-11,14,21H2,1H3,(H,23,25) |
| InChIKey | NCGBZGBGRIRBIR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|