C17H22F6N4O — CID 86666490
5-amino-4-(methylamino)-2-[4-(trifluoromethyl)piperidin-1-yl]-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 86666490) has the molecular formula C17H22F6N4O and a molecular weight of 412.38 g/mol. Its IUPAC name is 5-amino-4-(methylamino)-2-[4-(trifluoromethyl)piperidin-1-yl]-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 5-amino-4-(methylamino)-2-[4-(trifluoromethyl)piperidin-1-yl]-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 86666490 |
| Molecular Formula | C17H22F6N4O |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 5-amino-4-(methylamino)-2-[4-(trifluoromethyl)piperidin-1-yl]-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | CNc1cc(N2CCC(C(F)(F)F)CC2)c(C(=O)NCCC(F)(F)F)cc1N |
| InChI | InChI=1S/C17H22F6N4O/c1-25-13-9-14(27-6-2-10(3-7-27)17(21,22)23)11(8-12(13)24)15(28)26-5-4-16(18,19)20/h8-10,25H,2-7,24H2,1H3,(H,26,28) |
| InChIKey | LSXOJUZXTIBGEH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|