C20H23F3N4O — CID 167299959
2-amino-N-methyl-4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]benzamide (PubChem CID 167299959) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-amino-N-methyl-4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]benzamide.
| Compound Name | 2-amino-N-methyl-4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]benzamide |
|---|---|
| PubChem CID | 167299959 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-amino-N-methyl-4-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]benzamide |
| SMILES | CNC(=O)c1ccc(Nc2ccc(N3CCC(C(F)(F)F)CC3)cc2)cc1N |
| InChI | InChI=1S/C20H23F3N4O/c1-25-19(28)17-7-4-15(12-18(17)24)26-14-2-5-16(6-3-14)27-10-8-13(9-11-27)20(21,22)23/h2-7,12-13,26H,8-11,24H2,1H3,(H,25,28) |
| InChIKey | OQCQKGDIBCKRBK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|