C20H21F3N4 — CID 167300671
1-methyl-N-[4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]indazol-5-amine (PubChem CID 167300671) has the molecular formula C20H21F3N4 and a molecular weight of 374.41 g/mol. Its IUPAC name is 1-methyl-N-[4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]indazol-5-amine.
| Compound Name | 1-methyl-N-[4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]indazol-5-amine |
|---|---|
| PubChem CID | 167300671 |
| Molecular Formula | C20H21F3N4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-methyl-N-[4-[4-(trifluoromethyl)piperidin-1-yl]phenyl]indazol-5-amine |
| SMILES | Cn1ncc2cc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)ccc21 |
| InChI | InChI=1S/C20H21F3N4/c1-26-19-7-4-17(12-14(19)13-24-26)25-16-2-5-18(6-3-16)27-10-8-15(9-11-27)20(21,22)23/h2-7,12-13,15,25H,8-11H2,1H3 |
| InChIKey | RJIBARLBUNJVJB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|