C23H27F3N4O2 — CID 167300693
3-[3-(methylamino)propyl]-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,3-benzoxazol-2-one (PubChem CID 167300693) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 3-[3-(methylamino)propyl]-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,3-benzoxazol-2-one.
| Compound Name | 3-[3-(methylamino)propyl]-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167300693 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 3-[3-(methylamino)propyl]-5-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-1,3-benzoxazol-2-one |
| SMILES | CNCCCn1c(=O)oc2ccc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cc21 |
| InChI | InChI=1S/C23H27F3N4O2/c1-27-11-2-12-30-20-15-18(5-8-21(20)32-22(30)31)28-17-3-6-19(7-4-17)29-13-9-16(10-14-29)23(24,25)26/h3-8,15-16,27-28H,2,9-14H2,1H3 |
| InChIKey | KKKLLBTZXXZXCT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|