C19H19F3N4O2 — CID 167300326
7-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 167300326) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is 7-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 7-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 167300326 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 7-[4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cc(Nc3ccc(N4CCC(C(F)(F)F)CC4)cc3)cnc2N1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)12-5-7-26(8-6-12)15-3-1-13(2-4-15)24-14-9-16-18(23-10-14)25-17(27)11-28-16/h1-4,9-10,12,24H,5-8,11H2,(H,23,25,27) |
| InChIKey | PWNNYZCSBACDET-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|