C21H22F3N3O3 — CID 167300460
7-[3-methoxy-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-1,4-benzoxazin-3-one (PubChem CID 167300460) has the molecular formula C21H22F3N3O3 and a molecular weight of 421.42 g/mol. Its IUPAC name is 7-[3-methoxy-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[3-methoxy-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 167300460 |
| Molecular Formula | C21H22F3N3O3 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 7-[3-methoxy-4-[4-(trifluoromethyl)piperidin-1-yl]anilino]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(Nc2ccc3c(c2)OCC(=O)N3)ccc1N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H22F3N3O3/c1-29-19-11-15(25-14-2-4-16-18(10-14)30-12-20(28)26-16)3-5-17(19)27-8-6-13(7-9-27)21(22,23)24/h2-5,10-11,13,25H,6-9,12H2,1H3,(H,26,28) |
| InChIKey | BNEHTHQTDNHLIT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|