C20H16N2O6 — CID 20917441
3-(3,4-dimethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione (PubChem CID 20917441) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-(3,4-dimethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3,4-dimethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917441 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-(3,4-dimethoxyanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
| SMILES | COc1ccc(Nc2c(-c3ccc4c(c3)OCC(=O)N4)c(=O)c2=O)cc1OC |
| InChI | InChI=1S/C20H16N2O6/c1-26-13-6-4-11(8-15(13)27-2)21-18-17(19(24)20(18)25)10-3-5-12-14(7-10)28-9-16(23)22-12/h3-8,21H,9H2,1-2H3,(H,22,23) |
| InChIKey | IYYDWSWQVKIODI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|