C18H11FN2O4 — CID 20917459
3-(3-fluoroanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione (PubChem CID 20917459) has the molecular formula C18H11FN2O4 and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-fluoroanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917459 |
| Molecular Formula | C18H11FN2O4 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-(3-fluoroanilino)-4-(3-oxo-4H-1,4-benzoxazin-7-yl)cyclobut-3-ene-1,2-dione |
| SMILES | O=C1COc2cc(-c3c(Nc4cccc(F)c4)c(=O)c3=O)ccc2N1 |
| InChI | InChI=1S/C18H11FN2O4/c19-10-2-1-3-11(7-10)20-16-15(17(23)18(16)24)9-4-5-12-13(6-9)25-8-14(22)21-12/h1-7,20H,8H2,(H,21,22) |
| InChIKey | FIEDKJOKIBGAGV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|